C18H28O4 — CID 56836757
(2S,5S,9S,14S,15R)-2,15-dimethyl-17-oxatetracyclo[8.7.0.02,7.011,15]heptadec-7-ene-5,9,14-triol (PubChem CID 56836757) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is (2S,5S,9S,14S,15R)-2,15-dimethyl-17-oxatetracyclo[8.7.0.02,7.011,15]heptadec-7-ene-5,9,14-triol.
| Compound Name | (2S,5S,9S,14S,15R)-2,15-dimethyl-17-oxatetracyclo[8.7.0.02,7.011,15]heptadec-7-ene-5,9,14-triol |
|---|---|
| PubChem CID | 56836757 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | (2S,5S,9S,14S,15R)-2,15-dimethyl-17-oxatetracyclo[8.7.0.02,7.011,15]heptadec-7-ene-5,9,14-triol |
| SMILES | C[C@]12CC[C@H](O)CC1=CC(O)C1C2OC[C@@]2(C)C1CC[C@@H]2O |
| InChI | InChI=1S/C18H28O4/c1-17-6-5-11(19)7-10(17)8-13(20)15-12-3-4-14(21)18(12,2)9-22-16(15)17/h8,11-16,19-21H,3-7,9H2,1-2H3/t11-,12?,13?,14-,15?,16?,17-,18-/m0/s1 |
| InChIKey | UCEVLNUBWMGPNO-RLHYSTMSSA-N |
| XLogP | 1.63 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|