C21H32F3NO4 — CID 56836798
2,3-dimethoxy-5-methyl-6-[10-(2,2,2-trifluoroethylamino)decyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 56836798) has the molecular formula C21H32F3NO4 and a molecular weight of 419.48 g/mol. Its IUPAC name is 2,3-dimethoxy-5-methyl-6-[10-(2,2,2-trifluoroethylamino)decyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3-dimethoxy-5-methyl-6-[10-(2,2,2-trifluoroethylamino)decyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 56836798 |
| Molecular Formula | C21H32F3NO4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 2,3-dimethoxy-5-methyl-6-[10-(2,2,2-trifluoroethylamino)decyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(OC)C(=O)C(CCCCCCCCCCNCC(F)(F)F)=C(C)C1=O |
| InChI | InChI=1S/C21H32F3NO4/c1-15-16(18(27)20(29-3)19(28-2)17(15)26)12-10-8-6-4-5-7-9-11-13-25-14-21(22,23)24/h25H,4-14H2,1-3H3 |
| InChIKey | STTSQQDLGOMXKO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|