C23H37NO4 — CID 56836870
2,3-dimethoxy-5-methyl-6-(10-pyrrolidin-1-yldecyl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 56836870) has the molecular formula C23H37NO4 and a molecular weight of 391.55 g/mol. Its IUPAC name is 2,3-dimethoxy-5-methyl-6-(10-pyrrolidin-1-yldecyl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3-dimethoxy-5-methyl-6-(10-pyrrolidin-1-yldecyl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 56836870 |
| Molecular Formula | C23H37NO4 |
| Molecular Weight | 391.55 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | 2,3-dimethoxy-5-methyl-6-(10-pyrrolidin-1-yldecyl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(OC)C(=O)C(CCCCCCCCCCN2CCCC2)=C(C)C1=O |
| InChI | InChI=1S/C23H37NO4/c1-18-19(21(26)23(28-3)22(27-2)20(18)25)14-10-8-6-4-5-7-9-11-15-24-16-12-13-17-24/h4-17H2,1-3H3 |
| InChIKey | FBQRHJMBRZYUNN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|