C28H31FN4O7 — CID 56836890
(4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-8-[1-(2-methylpropyl)imidazol-2-yl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 56836890) has the molecular formula C28H31FN4O7 and a molecular weight of 554.58 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-8-[1-(2-methylpropyl)imidazol-2-yl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-8-[1-(2-methylpropyl)imidazol-2-yl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 56836890 |
| Molecular Formula | C28H31FN4O7 |
| Molecular Weight | 554.58 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-8-[1-(2-methylpropyl)imidazol-2-yl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC(C)Cn1ccnc1-c1cc(O)c2c(c1F)C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C28H31FN4O7/c1-11(2)10-33-6-5-31-27(33)14-9-16(34)18-13(20(14)29)7-12-8-15-21(32(3)4)23(36)19(26(30)39)25(38)28(15,40)24(37)17(12)22(18)35/h5-6,9,11-12,15,21,34-35,38,40H,7-8,10H2,1-4H3,(H2,30,39)/t12-,15-,21-,28-/m0/s1 |
| InChIKey | QVOZCFLSOBRHBW-RBMSIWGPSA-N |
| XLogP | 1.62 |
| TPSA | 179.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.58 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|