About N'-[4-[3-(difluoromethoxy)phenyl]sulfanyl-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide
N'-[4-[3-(difluoromethoxy)phenyl]sulfanyl-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 56837185) has the molecular formula C19H22F2N2OS
and a molecular weight of 364.46 g/mol. Its IUPAC name is N'-[4-[3-(difluoromethoxy)phenyl]sulfanyl-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide.
Molecular Properties
| Compound Name | N'-[4-[3-(difluoromethoxy)phenyl]sulfanyl-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
| PubChem CID | 56837185 |
| Molecular Formula | C19H22F2N2OS |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | N'-[4-[3-(difluoromethoxy)phenyl]sulfanyl-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Sc2cccc(OC(F)F)c2)cc1C |
| InChI | InChI=1S/C19H22F2N2OS/c1-5-23(4)12-22-17-9-14(3)18(10-13(17)2)25-16-8-6-7-15(11-16)24-19(20)21/h6-12,19H,5H2,1-4H3/b22-12+ |
| InChIKey | FXLMOAQSXRPYGT-WSDLNYQXSA-N |
| XLogP | 5.67 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[4-[3-(difluoromethoxy)phenyl]sulfanyl-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[4-[3-(difluoromethoxy)phenyl]sulfanyl-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide?
The IUPAC name of N'-[4-[3-(difluoromethoxy)phenyl]sulfanyl-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide (CID 56837185) is N'-[4-[3-(difluoromethoxy)phenyl]sulfanyl-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide.
What is the SMILES notation for N'-[4-[3-(difluoromethoxy)phenyl]sulfanyl-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide?
The canonical SMILES for N'-[4-[3-(difluoromethoxy)phenyl]sulfanyl-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide is CCN(C)/C=N/c1cc(C)c(Sc2cccc(OC(F)F)c2)cc1C.
What is the InChIKey of N'-[4-[3-(difluoromethoxy)phenyl]sulfanyl-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide?
The InChIKey is FXLMOAQSXRPYGT-WSDLNYQXSA-N. The full InChI is InChI=1S/C19H22F2N2OS/c1-5-23(4)12-22-17-9-14(3)18(10-13(17)2)25-16-8-6-7-15(11-16)24-19(20)21/h6-12,19H,5H2,1-4H3/b22-12+.
What are the key properties of N'-[4-[3-(difluoromethoxy)phenyl]sulfanyl-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide?
N'-[4-[3-(difluoromethoxy)phenyl]sulfanyl-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide has a molecular weight of 364.46 g/mol, XLogP of 5.67, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[4-[3-(difluoromethoxy)phenyl]sulfanyl-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide is sourced from PubChem (CID 56837185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).