About 4-methyl-N-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]benzenesulfonamide
4-methyl-N-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]benzenesulfonamide (PubChem CID 56837207) has the molecular formula C10H12F3NO3S
and a molecular weight of 283.27 g/mol. Its IUPAC name is 4-methyl-N-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-methyl-N-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]benzenesulfonamide |
| PubChem CID | 56837207 |
| Molecular Formula | C10H12F3NO3S |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 4-methyl-N-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC[C@H](O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H12F3NO3S/c1-7-2-4-8(5-3-7)18(16,17)14-6-9(15)10(11,12)13/h2-5,9,14-15H,6H2,1H3/t9-/m0/s1 |
| InChIKey | NEQNQSAREORJJM-VIFPVBQESA-N |
| XLogP | 1.20 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-N-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]benzenesulfonamide?
The IUPAC name of 4-methyl-N-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]benzenesulfonamide (CID 56837207) is 4-methyl-N-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]benzenesulfonamide.
What is the SMILES notation for 4-methyl-N-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]benzenesulfonamide?
The canonical SMILES for 4-methyl-N-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]benzenesulfonamide is Cc1ccc(S(=O)(=O)NC[C@H](O)C(F)(F)F)cc1.
What is the InChIKey of 4-methyl-N-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]benzenesulfonamide?
The InChIKey is NEQNQSAREORJJM-VIFPVBQESA-N. The full InChI is InChI=1S/C10H12F3NO3S/c1-7-2-4-8(5-3-7)18(16,17)14-6-9(15)10(11,12)13/h2-5,9,14-15H,6H2,1H3/t9-/m0/s1.
What are the key properties of 4-methyl-N-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]benzenesulfonamide?
4-methyl-N-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]benzenesulfonamide has a molecular weight of 283.27 g/mol, XLogP of 1.20, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]benzenesulfonamide is sourced from PubChem (CID 56837207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).