C23H31NO4S — CID 56837604
5-but-1-ynyl-3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid (PubChem CID 56837604) has the molecular formula C23H31NO4S and a molecular weight of 417.57 g/mol. Its IUPAC name is 5-but-1-ynyl-3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid.
| Compound Name | 5-but-1-ynyl-3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 56837604 |
| Molecular Formula | C23H31NO4S |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 5-but-1-ynyl-3-[(4-hydroxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid |
| SMILES | CCC#Cc1cc(N(C(=O)C2CCC(C)CC2)C2CCC(O)CC2)c(C(=O)O)s1 |
| InChI | InChI=1S/C23H31NO4S/c1-3-4-5-19-14-20(21(29-19)23(27)28)24(17-10-12-18(25)13-11-17)22(26)16-8-6-15(2)7-9-16/h14-18,25H,3,6-13H2,1-2H3,(H,27,28) |
| InChIKey | MESYVDYBQOZJSK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|