C13H15Cl2NO6S2 — CID 56837660
[(4R)-2-(dichloromethyl)-5-(4-methylsulfonylphenyl)-4,5-dihydro-1,3-oxazol-4-yl]methyl methanesulfonate (PubChem CID 56837660) has the molecular formula C13H15Cl2NO6S2 and a molecular weight of 416.30 g/mol. Its IUPAC name is [(4R)-2-(dichloromethyl)-5-(4-methylsulfonylphenyl)-4,5-dihydro-1,3-oxazol-4-yl]methyl methanesulfonate.
| Compound Name | [(4R)-2-(dichloromethyl)-5-(4-methylsulfonylphenyl)-4,5-dihydro-1,3-oxazol-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 56837660 |
| Molecular Formula | C13H15Cl2NO6S2 |
| Molecular Weight | 416.30 g/mol |
| Exact Mass | 414.97 |
| IUPAC Name | [(4R)-2-(dichloromethyl)-5-(4-methylsulfonylphenyl)-4,5-dihydro-1,3-oxazol-4-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@H]1N=C(C(Cl)Cl)OC1c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H15Cl2NO6S2/c1-23(17,18)9-5-3-8(4-6-9)11-10(7-21-24(2,19)20)16-13(22-11)12(14)15/h3-6,10-12H,7H2,1-2H3/t10-,11?/m1/s1 |
| InChIKey | KWYPUPCNEAYGSF-NFJWQWPMSA-N |
| XLogP | 1.71 |
| TPSA | 99.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|