C19H20O2S — CID 56837717
(3aS,6aS)-6a-methyl-2-phenylsulfanylspiro[3,3a,4,6-tetrahydro-2H-cyclopenta[b]furan-5,4'-cyclohexa-2,5-diene]-1'-one (PubChem CID 56837717) has the molecular formula C19H20O2S and a molecular weight of 312.43 g/mol. Its IUPAC name is (3aS,6aS)-6a-methyl-2-phenylsulfanylspiro[3,3a,4,6-tetrahydro-2H-cyclopenta[b]furan-5,4'-cyclohexa-2,5-diene]-1'-one.
| Compound Name | (3aS,6aS)-6a-methyl-2-phenylsulfanylspiro[3,3a,4,6-tetrahydro-2H-cyclopenta[b]furan-5,4'-cyclohexa-2,5-diene]-1'-one |
|---|---|
| PubChem CID | 56837717 |
| Molecular Formula | C19H20O2S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | (3aS,6aS)-6a-methyl-2-phenylsulfanylspiro[3,3a,4,6-tetrahydro-2H-cyclopenta[b]furan-5,4'-cyclohexa-2,5-diene]-1'-one |
| SMILES | C[C@]12CC3(C=CC(=O)C=C3)C[C@H]1CC(Sc1ccccc1)O2 |
| InChI | InChI=1S/C19H20O2S/c1-18-13-19(9-7-15(20)8-10-19)12-14(18)11-17(21-18)22-16-5-3-2-4-6-16/h2-10,14,17H,11-13H2,1H3/t14-,17?,18+/m1/s1 |
| InChIKey | PPKSRQYYFSSRKN-CFNGDTMJSA-N |
| XLogP | 4.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |