About [2,2-difluoro-1-(2-methoxyethoxymethoxy)ethenyl]benzene
[2,2-difluoro-1-(2-methoxyethoxymethoxy)ethenyl]benzene (PubChem CID 56837742) has the molecular formula C12H14F2O3
and a molecular weight of 244.24 g/mol. Its IUPAC name is [2,2-difluoro-1-(2-methoxyethoxymethoxy)ethenyl]benzene.
Molecular Properties
| Compound Name | [2,2-difluoro-1-(2-methoxyethoxymethoxy)ethenyl]benzene |
| PubChem CID | 56837742 |
| Molecular Formula | C12H14F2O3 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | [2,2-difluoro-1-(2-methoxyethoxymethoxy)ethenyl]benzene |
| SMILES | COCCOCOC(=C(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H14F2O3/c1-15-7-8-16-9-17-11(12(13)14)10-5-3-2-4-6-10/h2-6H,7-9H2,1H3 |
| InChIKey | LQTYYKQPQJPZME-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [2,2-difluoro-1-(2-methoxyethoxymethoxy)ethenyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-difluoro-1-(2-methoxyethoxymethoxy)ethenyl]benzene?
The IUPAC name of [2,2-difluoro-1-(2-methoxyethoxymethoxy)ethenyl]benzene (CID 56837742) is [2,2-difluoro-1-(2-methoxyethoxymethoxy)ethenyl]benzene.
What is the SMILES notation for [2,2-difluoro-1-(2-methoxyethoxymethoxy)ethenyl]benzene?
The canonical SMILES for [2,2-difluoro-1-(2-methoxyethoxymethoxy)ethenyl]benzene is COCCOCOC(=C(F)F)c1ccccc1.
What is the InChIKey of [2,2-difluoro-1-(2-methoxyethoxymethoxy)ethenyl]benzene?
The InChIKey is LQTYYKQPQJPZME-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2O3/c1-15-7-8-16-9-17-11(12(13)14)10-5-3-2-4-6-10/h2-6H,7-9H2,1H3.
What are the key properties of [2,2-difluoro-1-(2-methoxyethoxymethoxy)ethenyl]benzene?
[2,2-difluoro-1-(2-methoxyethoxymethoxy)ethenyl]benzene has a molecular weight of 244.24 g/mol, XLogP of 2.89, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-difluoro-1-(2-methoxyethoxymethoxy)ethenyl]benzene is sourced from PubChem (CID 56837742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).