C25H51BO3Si — CID 56837862
tert-butyl-dimethyl-[(Z,2R,4S,8R)-2,4,8-trimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-6-enoxy]silane (PubChem CID 56837862) has the molecular formula C25H51BO3Si and a molecular weight of 438.58 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(Z,2R,4S,8R)-2,4,8-trimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-6-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(Z,2R,4S,8R)-2,4,8-trimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-6-enoxy]silane |
|---|---|
| PubChem CID | 56837862 |
| Molecular Formula | C25H51BO3Si |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.37 |
| IUPAC Name | tert-butyl-dimethyl-[(Z,2R,4S,8R)-2,4,8-trimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-6-enoxy]silane |
| SMILES | CC[C@@H](C)/C=C(\C[C@@H](C)C[C@@H](C)CO[Si](C)(C)C(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C25H51BO3Si/c1-14-19(2)16-22(26-28-24(8,9)25(10,11)29-26)17-20(3)15-21(4)18-27-30(12,13)23(5,6)7/h16,19-21H,14-15,17-18H2,1-13H3/b22-16+/t19-,20+,21-/m1/s1 |
| InChIKey | JOVOOFYPFMNREP-WHTNUWSKSA-N |
| XLogP | 7.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|