C13H13F5O3 — CID 56837962
1-[2,2-difluoro-1-(2-methoxyethoxymethoxy)ethenyl]-3-(trifluoromethyl)benzene (PubChem CID 56837962) has the molecular formula C13H13F5O3 and a molecular weight of 312.23 g/mol. Its IUPAC name is 1-[2,2-difluoro-1-(2-methoxyethoxymethoxy)ethenyl]-3-(trifluoromethyl)benzene.
| Compound Name | 1-[2,2-difluoro-1-(2-methoxyethoxymethoxy)ethenyl]-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 56837962 |
| Molecular Formula | C13H13F5O3 |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 1-[2,2-difluoro-1-(2-methoxyethoxymethoxy)ethenyl]-3-(trifluoromethyl)benzene |
| SMILES | COCCOCOC(=C(F)F)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F5O3/c1-19-5-6-20-8-21-11(12(14)15)9-3-2-4-10(7-9)13(16,17)18/h2-4,7H,5-6,8H2,1H3 |
| InChIKey | NMSUDJBTBCHPTI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|