C21H29NO3 — CID 56838003
(1S,2S,8S,11S)-13,15-dihydroxy-2,7,7,11-tetramethyl-6-azatetracyclo[9.7.0.02,8.012,17]octadeca-12(17),13,15-trien-5-one (PubChem CID 56838003) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is (1S,2S,8S,11S)-13,15-dihydroxy-2,7,7,11-tetramethyl-6-azatetracyclo[9.7.0.02,8.012,17]octadeca-12(17),13,15-trien-5-one.
| Compound Name | (1S,2S,8S,11S)-13,15-dihydroxy-2,7,7,11-tetramethyl-6-azatetracyclo[9.7.0.02,8.012,17]octadeca-12(17),13,15-trien-5-one |
|---|---|
| PubChem CID | 56838003 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | (1S,2S,8S,11S)-13,15-dihydroxy-2,7,7,11-tetramethyl-6-azatetracyclo[9.7.0.02,8.012,17]octadeca-12(17),13,15-trien-5-one |
| SMILES | CC1(C)NC(=O)CC[C@]2(C)[C@@H]1CC[C@]1(C)c3c(O)cc(O)cc3C[C@@H]21 |
| InChI | InChI=1S/C21H29NO3/c1-19(2)15-5-7-21(4)16(20(15,3)8-6-17(25)22-19)10-12-9-13(23)11-14(24)18(12)21/h9,11,15-16,23-24H,5-8,10H2,1-4H3,(H,22,25)/t15-,16+,20-,21+/m1/s1 |
| InChIKey | WNQNWORCVSHHJW-XTCWOQMQSA-N |
| XLogP | 3.63 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |