C20H18Cl2N2O4 — CID 56838090
dimethyl 1,3-bis(4-chlorophenyl)-2,4-dihydropyrimidine-5,6-dicarboxylate (PubChem CID 56838090) has the molecular formula C20H18Cl2N2O4 and a molecular weight of 421.28 g/mol. Its IUPAC name is dimethyl 1,3-bis(4-chlorophenyl)-2,4-dihydropyrimidine-5,6-dicarboxylate.
| Compound Name | dimethyl 1,3-bis(4-chlorophenyl)-2,4-dihydropyrimidine-5,6-dicarboxylate |
|---|---|
| PubChem CID | 56838090 |
| Molecular Formula | C20H18Cl2N2O4 |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | dimethyl 1,3-bis(4-chlorophenyl)-2,4-dihydropyrimidine-5,6-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(Cl)cc2)CN(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C20H18Cl2N2O4/c1-27-19(25)17-11-23(15-7-3-13(21)4-8-15)12-24(18(17)20(26)28-2)16-9-5-14(22)6-10-16/h3-10H,11-12H2,1-2H3 |
| InChIKey | CVJKYAHEPOOFMI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |