C31H44O4 — CID 56838491
(5Z)-5-(2-methoxy-2-methylpropylidene)-3-[(5R,9R,10R,13S,14S,17R)-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]furan-2-one (PubChem CID 56838491) has the molecular formula C31H44O4 and a molecular weight of 480.69 g/mol. Its IUPAC name is (5Z)-5-(2-methoxy-2-methylpropylidene)-3-[(5R,9R,10R,13S,14S,17R)-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]furan-2-one.
| Compound Name | (5Z)-5-(2-methoxy-2-methylpropylidene)-3-[(5R,9R,10R,13S,14S,17R)-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]furan-2-one |
|---|---|
| PubChem CID | 56838491 |
| Molecular Formula | C31H44O4 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | (5Z)-5-(2-methoxy-2-methylpropylidene)-3-[(5R,9R,10R,13S,14S,17R)-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]furan-2-one |
| SMILES | COC(C)(C)/C=C1/C=C([C@@H]2CC[C@]3(C)C4=CC[C@H]5C(C)(C)C(=O)CC[C@]5(C)[C@H]4CC[C@@]23C)C(=O)O1 |
| InChI | InChI=1S/C31H44O4/c1-27(2,34-8)18-19-17-20(26(33)35-19)21-11-15-31(7)23-9-10-24-28(3,4)25(32)13-14-29(24,5)22(23)12-16-30(21,31)6/h9,17-18,21-22,24H,10-16H2,1-8H3/b19-18-/t21-,22-,24-,29+,30-,31+/m0/s1 |
| InChIKey | FTFFMPMXQQDSQO-SHQRBJGESA-N |
| XLogP | 6.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|