C39H31NO5 — CID 56838578
methyl (Z)-3-[(5-oxo-2,6,7-triphenyl-3,4-dihydro-1,4-oxazepin-2-yl)oxy]-2,3-diphenylprop-2-enoate (PubChem CID 56838578) has the molecular formula C39H31NO5 and a molecular weight of 593.68 g/mol. Its IUPAC name is methyl (Z)-3-[(5-oxo-2,6,7-triphenyl-3,4-dihydro-1,4-oxazepin-2-yl)oxy]-2,3-diphenylprop-2-enoate.
| Compound Name | methyl (Z)-3-[(5-oxo-2,6,7-triphenyl-3,4-dihydro-1,4-oxazepin-2-yl)oxy]-2,3-diphenylprop-2-enoate |
|---|---|
| PubChem CID | 56838578 |
| Molecular Formula | C39H31NO5 |
| Molecular Weight | 593.68 g/mol |
| Exact Mass | 593.22 |
| IUPAC Name | methyl (Z)-3-[(5-oxo-2,6,7-triphenyl-3,4-dihydro-1,4-oxazepin-2-yl)oxy]-2,3-diphenylprop-2-enoate |
| SMILES | COC(=O)/C(=C(\OC1(c2ccccc2)CNC(=O)C(c2ccccc2)=C(c2ccccc2)O1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H31NO5/c1-43-38(42)34(29-19-9-3-10-20-29)36(31-23-13-5-14-24-31)45-39(32-25-15-6-16-26-32)27-40-37(41)33(28-17-7-2-8-18-28)35(44-39)30-21-11-4-12-22-30/h2-26H,27H2,1H3,(H,40,41)/b36-34- |
| InChIKey | BGHWRFOXOJSQFU-ZSWXBHCYSA-N |
| XLogP | 7.31 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.68 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|