C10H14O8 — CID 568388
1,4,7,10,13-pentaoxacyclopentadecane-2,5,9-trione (PubChem CID 568388) has the molecular formula C10H14O8 and a molecular weight of 262.21 g/mol. Its IUPAC name is 1,4,7,10,13-pentaoxacyclopentadecane-2,5,9-trione.
| Compound Name | 1,4,7,10,13-pentaoxacyclopentadecane-2,5,9-trione |
|---|---|
| PubChem CID | 568388 |
| Molecular Formula | C10H14O8 |
| Molecular Weight | 262.21 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 1,4,7,10,13-pentaoxacyclopentadecane-2,5,9-trione |
| SMILES | O=C1COCC(=O)OCC(=O)OCCOCCO1 |
| InChI | InChI=1S/C10H14O8/c11-8-5-15-6-9(12)18-7-10(13)17-4-2-14-1-3-16-8/h1-7H2 |
| InChIKey | DHUWIROMNMQGIC-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.21 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|