C10H16N2O6 — CID 568389
1,4,10-trioxa-7,13-diazacyclopentadecane-2,6,14-trione (PubChem CID 568389) has the molecular formula C10H16N2O6 and a molecular weight of 260.25 g/mol. Its IUPAC name is 1,4,10-trioxa-7,13-diazacyclopentadecane-2,6,14-trione.
| Compound Name | 1,4,10-trioxa-7,13-diazacyclopentadecane-2,6,14-trione |
|---|---|
| PubChem CID | 568389 |
| Molecular Formula | C10H16N2O6 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 1,4,10-trioxa-7,13-diazacyclopentadecane-2,6,14-trione |
| SMILES | O=C1COCC(=O)OCC(=O)NCCOCCN1 |
| InChI | InChI=1S/C10H16N2O6/c13-8-5-17-7-10(15)18-6-9(14)12-2-4-16-3-1-11-8/h1-7H2,(H,11,13)(H,12,14) |
| InChIKey | IGBBAFBZOHGCIZ-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |