About 3-(3-bromo-1-benzothiophen-2-yl)-5,6-dihydro-1,4,2-oxathiazine 4-oxide
3-(3-bromo-1-benzothiophen-2-yl)-5,6-dihydro-1,4,2-oxathiazine 4-oxide (PubChem CID 56839090) has the molecular formula C11H8BrNO2S2
and a molecular weight of 330.23 g/mol. Its IUPAC name is 3-(3-bromo-1-benzothiophen-2-yl)-5,6-dihydro-1,4,2-oxathiazine 4-oxide.
Molecular Properties
| Compound Name | 3-(3-bromo-1-benzothiophen-2-yl)-5,6-dihydro-1,4,2-oxathiazine 4-oxide |
| PubChem CID | 56839090 |
| Molecular Formula | C11H8BrNO2S2 |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 328.92 |
| IUPAC Name | 3-(3-bromo-1-benzothiophen-2-yl)-5,6-dihydro-1,4,2-oxathiazine 4-oxide |
| SMILES | O=S1CCON=C1c1sc2ccccc2c1Br |
| InChI | InChI=1S/C11H8BrNO2S2/c12-9-7-3-1-2-4-8(7)16-10(9)11-13-15-5-6-17(11)14/h1-4H,5-6H2 |
| InChIKey | STFXHBUBVQMGOK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3-bromo-1-benzothiophen-2-yl)-5,6-dihydro-1,4,2-oxathiazine 4-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-bromo-1-benzothiophen-2-yl)-5,6-dihydro-1,4,2-oxathiazine 4-oxide?
The IUPAC name of 3-(3-bromo-1-benzothiophen-2-yl)-5,6-dihydro-1,4,2-oxathiazine 4-oxide (CID 56839090) is 3-(3-bromo-1-benzothiophen-2-yl)-5,6-dihydro-1,4,2-oxathiazine 4-oxide.
What is the SMILES notation for 3-(3-bromo-1-benzothiophen-2-yl)-5,6-dihydro-1,4,2-oxathiazine 4-oxide?
The canonical SMILES for 3-(3-bromo-1-benzothiophen-2-yl)-5,6-dihydro-1,4,2-oxathiazine 4-oxide is O=S1CCON=C1c1sc2ccccc2c1Br.
What is the InChIKey of 3-(3-bromo-1-benzothiophen-2-yl)-5,6-dihydro-1,4,2-oxathiazine 4-oxide?
The InChIKey is STFXHBUBVQMGOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8BrNO2S2/c12-9-7-3-1-2-4-8(7)16-10(9)11-13-15-5-6-17(11)14/h1-4H,5-6H2.
What are the key properties of 3-(3-bromo-1-benzothiophen-2-yl)-5,6-dihydro-1,4,2-oxathiazine 4-oxide?
3-(3-bromo-1-benzothiophen-2-yl)-5,6-dihydro-1,4,2-oxathiazine 4-oxide has a molecular weight of 330.23 g/mol, XLogP of 3.10, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-bromo-1-benzothiophen-2-yl)-5,6-dihydro-1,4,2-oxathiazine 4-oxide is sourced from PubChem (CID 56839090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).