C29H33Cl2F4N5O3 — CID 56839119
2-[2,6-dichloro-3-[(2,2-dimethylpropanoylamino)methyl]anilino]-N-(4,4-difluorocyclohexyl)-6-(2,2-difluoroethoxy)-1-methylbenzimidazole-5-carboxamide (PubChem CID 56839119) has the molecular formula C29H33Cl2F4N5O3 and a molecular weight of 646.51 g/mol. Its IUPAC name is 2-[2,6-dichloro-3-[(2,2-dimethylpropanoylamino)methyl]anilino]-N-(4,4-difluorocyclohexyl)-6-(2,2-difluoroethoxy)-1-methylbenzimidazole-5-carboxamide.
| Compound Name | 2-[2,6-dichloro-3-[(2,2-dimethylpropanoylamino)methyl]anilino]-N-(4,4-difluorocyclohexyl)-6-(2,2-difluoroethoxy)-1-methylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 56839119 |
| Molecular Formula | C29H33Cl2F4N5O3 |
| Molecular Weight | 646.51 g/mol |
| Exact Mass | 645.19 |
| IUPAC Name | 2-[2,6-dichloro-3-[(2,2-dimethylpropanoylamino)methyl]anilino]-N-(4,4-difluorocyclohexyl)-6-(2,2-difluoroethoxy)-1-methylbenzimidazole-5-carboxamide |
| SMILES | Cn1c(Nc2c(Cl)ccc(CNC(=O)C(C)(C)C)c2Cl)nc2cc(C(=O)NC3CCC(F)(F)CC3)c(OCC(F)F)cc21 |
| InChI | InChI=1S/C29H33Cl2F4N5O3/c1-28(2,3)26(42)36-13-15-5-6-18(30)24(23(15)31)39-27-38-19-11-17(21(43-14-22(32)33)12-20(19)40(27)4)25(41)37-16-7-9-29(34,35)10-8-16/h5-6,11-12,16,22H,7-10,13-14H2,1-4H3,(H,36,42)(H,37,41)(H,38,39) |
| InChIKey | YIIBOPVEDFQYCV-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.51 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |