C15H20O4 — CID 56839381
(3aS,5aS,8R,8aS,9S,9aS)-8,9-dihydroxy-5,8-dimethyl-1-methylidene-5a,6,7,8a,9,9a-hexahydro-3aH-azuleno[6,5-b]furan-2-one (PubChem CID 56839381) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (3aS,5aS,8R,8aS,9S,9aS)-8,9-dihydroxy-5,8-dimethyl-1-methylidene-5a,6,7,8a,9,9a-hexahydro-3aH-azuleno[6,5-b]furan-2-one.
| Compound Name | (3aS,5aS,8R,8aS,9S,9aS)-8,9-dihydroxy-5,8-dimethyl-1-methylidene-5a,6,7,8a,9,9a-hexahydro-3aH-azuleno[6,5-b]furan-2-one |
|---|---|
| PubChem CID | 56839381 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (3aS,5aS,8R,8aS,9S,9aS)-8,9-dihydroxy-5,8-dimethyl-1-methylidene-5a,6,7,8a,9,9a-hexahydro-3aH-azuleno[6,5-b]furan-2-one |
| SMILES | C=C1C(=O)O[C@H]2C=C(C)[C@H]3CC[C@@](C)(O)[C@@H]3[C@@H](O)[C@H]12 |
| InChI | InChI=1S/C15H20O4/c1-7-6-10-11(8(2)14(17)19-10)13(16)12-9(7)4-5-15(12,3)18/h6,9-13,16,18H,2,4-5H2,1,3H3/t9-,10+,11-,12+,13+,15-/m1/s1 |
| InChIKey | OXQNNDVRKSCCAV-YZDFOLFKSA-N |
| XLogP | 1.18 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|