C16H13NO4 — CID 56840384
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-pyridin-2-ylpropane-1,3-dione (PubChem CID 56840384) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-pyridin-2-ylpropane-1,3-dione.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-pyridin-2-ylpropane-1,3-dione |
|---|---|
| PubChem CID | 56840384 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-pyridin-2-ylpropane-1,3-dione |
| SMILES | O=C(CC(=O)c1ccccn1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H13NO4/c18-13(10-14(19)12-3-1-2-6-17-12)11-4-5-15-16(9-11)21-8-7-20-15/h1-6,9H,7-8,10H2 |
| InChIKey | AGZRYXKMMCAJLL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|