C22H24O7 — CID 56840387
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-[3-(2-methoxyethoxymethoxy)phenyl]butane-1,4-dione (PubChem CID 56840387) has the molecular formula C22H24O7 and a molecular weight of 400.43 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-[3-(2-methoxyethoxymethoxy)phenyl]butane-1,4-dione.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-[3-(2-methoxyethoxymethoxy)phenyl]butane-1,4-dione |
|---|---|
| PubChem CID | 56840387 |
| Molecular Formula | C22H24O7 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-[3-(2-methoxyethoxymethoxy)phenyl]butane-1,4-dione |
| SMILES | COCCOCOc1cccc(C(=O)CCC(=O)c2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C22H24O7/c1-25-9-10-26-15-29-18-4-2-3-16(13-18)19(23)6-7-20(24)17-5-8-21-22(14-17)28-12-11-27-21/h2-5,8,13-14H,6-7,9-12,15H2,1H3 |
| InChIKey | GDIVADQVBLRGSM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|