About N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]quinolin-4-amine;hydrochloride
N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]quinolin-4-amine;hydrochloride (PubChem CID 56840764) has the molecular formula C19H20BrClN2O2
and a molecular weight of 423.74 g/mol. Its IUPAC name is N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]quinolin-4-amine;hydrochloride.
Molecular Properties
| Compound Name | N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]quinolin-4-amine;hydrochloride |
| PubChem CID | 56840764 |
| Molecular Formula | C19H20BrClN2O2 |
| Molecular Weight | 423.74 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]quinolin-4-amine;hydrochloride |
| SMILES | COc1cc(Br)c(CCNc2ccnc3ccccc23)cc1OC.Cl |
| InChI | InChI=1S/C19H19BrN2O2.ClH/c1-23-18-11-13(15(20)12-19(18)24-2)7-9-21-17-8-10-22-16-6-4-3-5-14(16)17;/h3-6,8,10-12H,7,9H2,1-2H3,(H,21,22);1H |
| InChIKey | XITOBUCCKRWECP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.74 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]quinolin-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]quinolin-4-amine;hydrochloride?
The IUPAC name of N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]quinolin-4-amine;hydrochloride (CID 56840764) is N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]quinolin-4-amine;hydrochloride.
What is the SMILES notation for N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]quinolin-4-amine;hydrochloride?
The canonical SMILES for N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]quinolin-4-amine;hydrochloride is COc1cc(Br)c(CCNc2ccnc3ccccc23)cc1OC.Cl.
What is the InChIKey of N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]quinolin-4-amine;hydrochloride?
The InChIKey is XITOBUCCKRWECP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19BrN2O2.ClH/c1-23-18-11-13(15(20)12-19(18)24-2)7-9-21-17-8-10-22-16-6-4-3-5-14(16)17;/h3-6,8,10-12H,7,9H2,1-2H3,(H,21,22);1H.
What are the key properties of N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]quinolin-4-amine;hydrochloride?
N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]quinolin-4-amine;hydrochloride has a molecular weight of 423.74 g/mol, XLogP of 5.09, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]quinolin-4-amine;hydrochloride is sourced from PubChem (CID 56840764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).