About disodium;2-(2-butoxyethoxy)ethyl phosphate
disodium;2-(2-butoxyethoxy)ethyl phosphate (PubChem CID 56841520) has the molecular formula C8H17Na2O6P
and a molecular weight of 286.17 g/mol. Its IUPAC name is disodium;2-(2-butoxyethoxy)ethyl phosphate.
Molecular Properties
| Compound Name | disodium;2-(2-butoxyethoxy)ethyl phosphate |
| PubChem CID | 56841520 |
| Molecular Formula | C8H17Na2O6P |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | disodium;2-(2-butoxyethoxy)ethyl phosphate |
| SMILES | CCCCOCCOCCOP(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C8H19O6P.2Na/c1-2-3-4-12-5-6-13-7-8-14-15(9,10)11;;/h2-8H2,1H3,(H2,9,10,11);;/q;2*+1/p-2 |
| InChIKey | DSBYJZUBAROODD-UHFFFAOYSA-L |
| XLogP | -6.33 |
| TPSA | 90.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | -6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze disodium;2-(2-butoxyethoxy)ethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;2-(2-butoxyethoxy)ethyl phosphate?
The IUPAC name of disodium;2-(2-butoxyethoxy)ethyl phosphate (CID 56841520) is disodium;2-(2-butoxyethoxy)ethyl phosphate.
What is the SMILES notation for disodium;2-(2-butoxyethoxy)ethyl phosphate?
The canonical SMILES for disodium;2-(2-butoxyethoxy)ethyl phosphate is CCCCOCCOCCOP(=O)([O-])[O-].[Na+].[Na+].
What is the InChIKey of disodium;2-(2-butoxyethoxy)ethyl phosphate?
The InChIKey is DSBYJZUBAROODD-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H19O6P.2Na/c1-2-3-4-12-5-6-13-7-8-14-15(9,10)11;;/h2-8H2,1H3,(H2,9,10,11);;/q;2*+1/p-2.
What are the key properties of disodium;2-(2-butoxyethoxy)ethyl phosphate?
disodium;2-(2-butoxyethoxy)ethyl phosphate has a molecular weight of 286.17 g/mol, XLogP of -6.33, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;2-(2-butoxyethoxy)ethyl phosphate is sourced from PubChem (CID 56841520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).