C14H28O17Tc — CID 56841673
bis((2R,3S,4S,5S,6R)-2,3,4,5,6,7-hexahydroxyheptanoic acid);oxotechnetium (PubChem CID 56841673) has the molecular formula C14H28O17Tc and a molecular weight of 566.36 g/mol. Its IUPAC name is bis((2R,3S,4S,5S,6R)-2,3,4,5,6,7-hexahydroxyheptanoic acid);oxotechnetium.
| Compound Name | bis((2R,3S,4S,5S,6R)-2,3,4,5,6,7-hexahydroxyheptanoic acid);oxotechnetium |
|---|---|
| PubChem CID | 56841673 |
| Molecular Formula | C14H28O17Tc |
| Molecular Weight | 566.36 g/mol |
| Exact Mass | 565.04 |
| IUPAC Name | bis((2R,3S,4S,5S,6R)-2,3,4,5,6,7-hexahydroxyheptanoic acid);oxotechnetium |
| SMILES | O=C(O)[C@H](O)[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO.O=C(O)[C@H](O)[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO.O=[Tc] |
| InChI | InChI=1S/2C7H14O8.O.Tc/c2*8-1-2(9)3(10)4(11)5(12)6(13)7(14)15;;/h2*2-6,8-13H,1H2,(H,14,15);;/t2*2-,3+,4+,5+,6-;;/m11../s1 |
| InChIKey | DJBFSPNPMWOEEZ-MYNVXSDXSA-N |
| XLogP | -8.39 |
| TPSA | 334.43 Ų |
| H-Bond Donors | 14 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.36 |
| LogP ≤ 5 | -8.39 |
| H-Bond Donors ≤ 5 | 14 |
| H-Bond Acceptors ≤ 10 | 15 |