C6H13NO4 — CID 56841921
(2S,3S,4R,5S)-2-amino-3,4,5-trihydroxyhexanal (PubChem CID 56841921) has the molecular formula C6H13NO4 and a molecular weight of 163.17 g/mol. Its IUPAC name is (2S,3S,4R,5S)-2-amino-3,4,5-trihydroxyhexanal.
| Compound Name | (2S,3S,4R,5S)-2-amino-3,4,5-trihydroxyhexanal |
|---|---|
| PubChem CID | 56841921 |
| Molecular Formula | C6H13NO4 |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | (2S,3S,4R,5S)-2-amino-3,4,5-trihydroxyhexanal |
| SMILES | C[C@H](O)[C@@H](O)[C@@H](O)[C@H](N)C=O |
| InChI | InChI=1S/C6H13NO4/c1-3(9)5(10)6(11)4(7)2-8/h2-6,9-11H,7H2,1H3/t3-,4+,5+,6-/m0/s1 |
| InChIKey | NTBYIQWZAVDRHA-KCDKBNATSA-N |
| XLogP | -2.38 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|