About [(5Z)-2,6-dimethylocta-5,7-dien-2-yl] acetate
[(5Z)-2,6-dimethylocta-5,7-dien-2-yl] acetate (PubChem CID 56841971) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is [(5Z)-2,6-dimethylocta-5,7-dien-2-yl] acetate.
Molecular Properties
| Compound Name | [(5Z)-2,6-dimethylocta-5,7-dien-2-yl] acetate |
| PubChem CID | 56841971 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | [(5Z)-2,6-dimethylocta-5,7-dien-2-yl] acetate |
| SMILES | C=C/C(C)=C\CCC(C)(C)OC(C)=O |
| InChI | InChI=1S/C12H20O2/c1-6-10(2)8-7-9-12(4,5)14-11(3)13/h6,8H,1,7,9H2,2-5H3/b10-8- |
| InChIKey | JAVBVYXSVDXAQK-NTMALXAHSA-N |
| XLogP | 3.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(5Z)-2,6-dimethylocta-5,7-dien-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5Z)-2,6-dimethylocta-5,7-dien-2-yl] acetate?
The IUPAC name of [(5Z)-2,6-dimethylocta-5,7-dien-2-yl] acetate (CID 56841971) is [(5Z)-2,6-dimethylocta-5,7-dien-2-yl] acetate.
What is the SMILES notation for [(5Z)-2,6-dimethylocta-5,7-dien-2-yl] acetate?
The canonical SMILES for [(5Z)-2,6-dimethylocta-5,7-dien-2-yl] acetate is C=C/C(C)=C\CCC(C)(C)OC(C)=O.
What is the InChIKey of [(5Z)-2,6-dimethylocta-5,7-dien-2-yl] acetate?
The InChIKey is JAVBVYXSVDXAQK-NTMALXAHSA-N. The full InChI is InChI=1S/C12H20O2/c1-6-10(2)8-7-9-12(4,5)14-11(3)13/h6,8H,1,7,9H2,2-5H3/b10-8-.
What are the key properties of [(5Z)-2,6-dimethylocta-5,7-dien-2-yl] acetate?
[(5Z)-2,6-dimethylocta-5,7-dien-2-yl] acetate has a molecular weight of 196.29 g/mol, XLogP of 3.24, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(5Z)-2,6-dimethylocta-5,7-dien-2-yl] acetate is sourced from PubChem (CID 56841971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).