About 7-(diethylamino)-1',4'-dimethylspiro[chromene-2,3'-quinoxaline]-2'-one
7-(diethylamino)-1',4'-dimethylspiro[chromene-2,3'-quinoxaline]-2'-one (PubChem CID 56842003) has the molecular formula C22H25N3O2
and a molecular weight of 363.46 g/mol. Its IUPAC name is 7-(diethylamino)-1',4'-dimethylspiro[chromene-2,3'-quinoxaline]-2'-one.
Molecular Properties
| Compound Name | 7-(diethylamino)-1',4'-dimethylspiro[chromene-2,3'-quinoxaline]-2'-one |
| PubChem CID | 56842003 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 7-(diethylamino)-1',4'-dimethylspiro[chromene-2,3'-quinoxaline]-2'-one |
| SMILES | CCN(CC)c1ccc2c(c1)OC1(C=C2)C(=O)N(C)c2ccccc2N1C |
| InChI | InChI=1S/C22H25N3O2/c1-5-25(6-2)17-12-11-16-13-14-22(27-20(16)15-17)21(26)23(3)18-9-7-8-10-19(18)24(22)4/h7-15H,5-6H2,1-4H3 |
| InChIKey | ZXYGXVPPZLKHDH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|
Analyze 7-(diethylamino)-1',4'-dimethylspiro[chromene-2,3'-quinoxaline]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(diethylamino)-1',4'-dimethylspiro[chromene-2,3'-quinoxaline]-2'-one?
The IUPAC name of 7-(diethylamino)-1',4'-dimethylspiro[chromene-2,3'-quinoxaline]-2'-one (CID 56842003) is 7-(diethylamino)-1',4'-dimethylspiro[chromene-2,3'-quinoxaline]-2'-one.
What is the SMILES notation for 7-(diethylamino)-1',4'-dimethylspiro[chromene-2,3'-quinoxaline]-2'-one?
The canonical SMILES for 7-(diethylamino)-1',4'-dimethylspiro[chromene-2,3'-quinoxaline]-2'-one is CCN(CC)c1ccc2c(c1)OC1(C=C2)C(=O)N(C)c2ccccc2N1C.
What is the InChIKey of 7-(diethylamino)-1',4'-dimethylspiro[chromene-2,3'-quinoxaline]-2'-one?
The InChIKey is ZXYGXVPPZLKHDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3O2/c1-5-25(6-2)17-12-11-16-13-14-22(27-20(16)15-17)21(26)23(3)18-9-7-8-10-19(18)24(22)4/h7-15H,5-6H2,1-4H3.
What are the key properties of 7-(diethylamino)-1',4'-dimethylspiro[chromene-2,3'-quinoxaline]-2'-one?
7-(diethylamino)-1',4'-dimethylspiro[chromene-2,3'-quinoxaline]-2'-one has a molecular weight of 363.46 g/mol, XLogP of 3.75, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(diethylamino)-1',4'-dimethylspiro[chromene-2,3'-quinoxaline]-2'-one is sourced from PubChem (CID 56842003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).