About magnesium bis(5-ethyl-2,6-dioxo-5-phenylpyrimidin-4-olate)
magnesium bis(5-ethyl-2,6-dioxo-5-phenylpyrimidin-4-olate) (PubChem CID 56842055) has the molecular formula C24H22MgN4O6
and a molecular weight of 486.77 g/mol. Its IUPAC name is magnesium bis(5-ethyl-2,6-dioxo-5-phenylpyrimidin-4-olate).
Molecular Properties
| Compound Name | magnesium bis(5-ethyl-2,6-dioxo-5-phenylpyrimidin-4-olate) |
| PubChem CID | 56842055 |
| Molecular Formula | C24H22MgN4O6 |
| Molecular Weight | 486.77 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | magnesium bis(5-ethyl-2,6-dioxo-5-phenylpyrimidin-4-olate) |
| SMILES | CCC1(c2ccccc2)C(=O)NC(=O)N=C1[O-].CCC1(c2ccccc2)C(=O)NC(=O)N=C1[O-].[Mg+2] |
| InChI | InChI=1S/2C12H12N2O3.Mg/c2*1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16;/h2*3-7H,2H2,1H3,(H2,13,14,15,16,17);/q;;+2/p-2 |
| InChIKey | LJVBIGYQTUCCSB-UHFFFAOYSA-L |
| XLogP | 0.31 |
| TPSA | 163.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.77 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze magnesium bis(5-ethyl-2,6-dioxo-5-phenylpyrimidin-4-olate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium bis(5-ethyl-2,6-dioxo-5-phenylpyrimidin-4-olate)?
The IUPAC name of magnesium bis(5-ethyl-2,6-dioxo-5-phenylpyrimidin-4-olate) (CID 56842055) is magnesium bis(5-ethyl-2,6-dioxo-5-phenylpyrimidin-4-olate).
What is the SMILES notation for magnesium bis(5-ethyl-2,6-dioxo-5-phenylpyrimidin-4-olate)?
The canonical SMILES for magnesium bis(5-ethyl-2,6-dioxo-5-phenylpyrimidin-4-olate) is CCC1(c2ccccc2)C(=O)NC(=O)N=C1[O-].CCC1(c2ccccc2)C(=O)NC(=O)N=C1[O-].[Mg+2].
What is the InChIKey of magnesium bis(5-ethyl-2,6-dioxo-5-phenylpyrimidin-4-olate)?
The InChIKey is LJVBIGYQTUCCSB-UHFFFAOYSA-L. The full InChI is InChI=1S/2C12H12N2O3.Mg/c2*1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16;/h2*3-7H,2H2,1H3,(H2,13,14,15,16,17);/q;;+2/p-2.
What are the key properties of magnesium bis(5-ethyl-2,6-dioxo-5-phenylpyrimidin-4-olate)?
magnesium bis(5-ethyl-2,6-dioxo-5-phenylpyrimidin-4-olate) has a molecular weight of 486.77 g/mol, XLogP of 0.31, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium bis(5-ethyl-2,6-dioxo-5-phenylpyrimidin-4-olate) is sourced from PubChem (CID 56842055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).