C10H7Cl7O — CID 56842305
(1R,2R,3S,4S,6S,7S)-1,4,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]dec-8-en-3-ol (PubChem CID 56842305) has the molecular formula C10H7Cl7O and a molecular weight of 391.34 g/mol. Its IUPAC name is (1R,2R,3S,4S,6S,7S)-1,4,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]dec-8-en-3-ol.
| Compound Name | (1R,2R,3S,4S,6S,7S)-1,4,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]dec-8-en-3-ol |
|---|---|
| PubChem CID | 56842305 |
| Molecular Formula | C10H7Cl7O |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 387.83 |
| IUPAC Name | (1R,2R,3S,4S,6S,7S)-1,4,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]dec-8-en-3-ol |
| SMILES | O[C@H]1[C@H]2[C@H](C[C@@H]1Cl)[C@]1(Cl)C(Cl)=C(Cl)[C@@]2(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C10H7Cl7O/c11-3-1-2-4(5(3)18)9(15)7(13)6(12)8(2,14)10(9,16)17/h2-5,18H,1H2/t2-,3-,4+,5+,8-,9+/m0/s1 |
| InChIKey | HCDQHPLINXKFPH-DCBFRJIESA-N |
| XLogP | 4.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|