About 3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-trimethylazanium;methyl sulfate
3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-trimethylazanium;methyl sulfate (PubChem CID 56842391) has the molecular formula C25H52N2O6S
and a molecular weight of 508.77 g/mol. Its IUPAC name is 3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-trimethylazanium;methyl sulfate.
Molecular Properties
| Compound Name | 3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-trimethylazanium;methyl sulfate |
| PubChem CID | 56842391 |
| Molecular Formula | C25H52N2O6S |
| Molecular Weight | 508.77 g/mol |
| Exact Mass | 508.35 |
| IUPAC Name | 3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-trimethylazanium;methyl sulfate |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)NCCC[N+](C)(C)C.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C24H48N2O2.CH4O4S/c1-5-6-7-14-18-23(27)19-15-12-10-8-9-11-13-16-20-24(28)25-21-17-22-26(2,3)4;1-5-6(2,3)4/h12,15,23,27H,5-11,13-14,16-22H2,1-4H3;1H3,(H,2,3,4)/b15-12-;/t23-;/m1./s1 |
| InChIKey | OJOKXBOONCXWCY-XCECJLTFSA-N |
| XLogP | 4.30 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 508.77 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-trimethylazanium;methyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-trimethylazanium;methyl sulfate?
The IUPAC name of 3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-trimethylazanium;methyl sulfate (CID 56842391) is 3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-trimethylazanium;methyl sulfate.
What is the SMILES notation for 3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-trimethylazanium;methyl sulfate?
The canonical SMILES for 3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-trimethylazanium;methyl sulfate is CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)NCCC[N+](C)(C)C.COS(=O)(=O)[O-].
What is the InChIKey of 3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-trimethylazanium;methyl sulfate?
The InChIKey is OJOKXBOONCXWCY-XCECJLTFSA-N. The full InChI is InChI=1S/C24H48N2O2.CH4O4S/c1-5-6-7-14-18-23(27)19-15-12-10-8-9-11-13-16-20-24(28)25-21-17-22-26(2,3)4;1-5-6(2,3)4/h12,15,23,27H,5-11,13-14,16-22H2,1-4H3;1H3,(H,2,3,4)/b15-12-;/t23-;/m1./s1.
What are the key properties of 3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-trimethylazanium;methyl sulfate?
3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-trimethylazanium;methyl sulfate has a molecular weight of 508.77 g/mol, XLogP of 4.30, 20 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-trimethylazanium;methyl sulfate is sourced from PubChem (CID 56842391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).