C9H14O — CID 56842481
(1S,2R,5R)-2,5-dimethylcyclohex-3-ene-1-carbaldehyde (PubChem CID 56842481) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is (1S,2R,5R)-2,5-dimethylcyclohex-3-ene-1-carbaldehyde.
| Compound Name | (1S,2R,5R)-2,5-dimethylcyclohex-3-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 56842481 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | (1S,2R,5R)-2,5-dimethylcyclohex-3-ene-1-carbaldehyde |
| SMILES | C[C@@H]1C=C[C@H](C)C[C@@H]1C=O |
| InChI | InChI=1S/C9H14O/c1-7-3-4-8(2)9(5-7)6-10/h3-4,6-9H,5H2,1-2H3/t7-,8+,9+/m0/s1 |
| InChIKey | HPEDKIIUXMEXNR-DJLDLDEBSA-N |
| XLogP | 2.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|