About (benzylamino)azanium;2-hydroxy-2-oxoacetate
(benzylamino)azanium;2-hydroxy-2-oxoacetate (PubChem CID 56842598) has the molecular formula C9H12N2O4
and a molecular weight of 212.21 g/mol. Its IUPAC name is (benzylamino)azanium;2-hydroxy-2-oxoacetate.
Molecular Properties
| Compound Name | (benzylamino)azanium;2-hydroxy-2-oxoacetate |
| PubChem CID | 56842598 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | (benzylamino)azanium;2-hydroxy-2-oxoacetate |
| SMILES | O=C([O-])C(=O)O.[NH3+]NCc1ccccc1 |
| InChI | InChI=1S/C7H10N2.C2H2O4/c8-9-6-7-4-2-1-3-5-7;3-1(4)2(5)6/h1-5,9H,6,8H2;(H,3,4)(H,5,6) |
| InChIKey | RCHUSXHCJLZTEY-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (benzylamino)azanium;2-hydroxy-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (benzylamino)azanium;2-hydroxy-2-oxoacetate?
The IUPAC name of (benzylamino)azanium;2-hydroxy-2-oxoacetate (CID 56842598) is (benzylamino)azanium;2-hydroxy-2-oxoacetate.
What is the SMILES notation for (benzylamino)azanium;2-hydroxy-2-oxoacetate?
The canonical SMILES for (benzylamino)azanium;2-hydroxy-2-oxoacetate is O=C([O-])C(=O)O.[NH3+]NCc1ccccc1.
What is the InChIKey of (benzylamino)azanium;2-hydroxy-2-oxoacetate?
The InChIKey is RCHUSXHCJLZTEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.C2H2O4/c8-9-6-7-4-2-1-3-5-7;3-1(4)2(5)6/h1-5,9H,6,8H2;(H,3,4)(H,5,6).
What are the key properties of (benzylamino)azanium;2-hydroxy-2-oxoacetate?
(benzylamino)azanium;2-hydroxy-2-oxoacetate has a molecular weight of 212.21 g/mol, XLogP of -2.25, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (benzylamino)azanium;2-hydroxy-2-oxoacetate is sourced from PubChem (CID 56842598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).