About bis((Z)-octadec-9-enoic acid);N'-[(Z)-octadec-9-enyl]propane-1,3-diamine
bis((Z)-octadec-9-enoic acid);N'-[(Z)-octadec-9-enyl]propane-1,3-diamine (PubChem CID 56842667) has the molecular formula C57H112N2O4
and a molecular weight of 889.53 g/mol. Its IUPAC name is bis((Z)-octadec-9-enoic acid);N'-[(Z)-octadec-9-enyl]propane-1,3-diamine.
Molecular Properties
| Compound Name | bis((Z)-octadec-9-enoic acid);N'-[(Z)-octadec-9-enyl]propane-1,3-diamine |
| PubChem CID | 56842667 |
| Molecular Formula | C57H112N2O4 |
| Molecular Weight | 889.53 g/mol |
| Exact Mass | 888.86 |
| IUPAC Name | bis((Z)-octadec-9-enoic acid);N'-[(Z)-octadec-9-enyl]propane-1,3-diamine |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O.CCCCCCCC/C=C\CCCCCCCC(=O)O.CCCCCCCC/C=C\CCCCCCCCNCCCN |
| InChI | InChI=1S/C21H44N2.2C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-23-21-18-19-22;2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10,23H,2-8,11-22H2,1H3;2*9-10H,2-8,11-17H2,1H3,(H,19,20)/b3*10-9- |
| InChIKey | VTXWSJAEIWTHCL-DJNDIFCPSA-N |
| XLogP | 18.18 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 63 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 889.53 |
| LogP ≤ 5 | 18.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis((Z)-octadec-9-enoic acid);N'-[(Z)-octadec-9-enyl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((Z)-octadec-9-enoic acid);N'-[(Z)-octadec-9-enyl]propane-1,3-diamine?
The IUPAC name of bis((Z)-octadec-9-enoic acid);N'-[(Z)-octadec-9-enyl]propane-1,3-diamine (CID 56842667) is bis((Z)-octadec-9-enoic acid);N'-[(Z)-octadec-9-enyl]propane-1,3-diamine.
What is the SMILES notation for bis((Z)-octadec-9-enoic acid);N'-[(Z)-octadec-9-enyl]propane-1,3-diamine?
The canonical SMILES for bis((Z)-octadec-9-enoic acid);N'-[(Z)-octadec-9-enyl]propane-1,3-diamine is CCCCCCCC/C=C\CCCCCCCC(=O)O.CCCCCCCC/C=C\CCCCCCCC(=O)O.CCCCCCCC/C=C\CCCCCCCCNCCCN.
What is the InChIKey of bis((Z)-octadec-9-enoic acid);N'-[(Z)-octadec-9-enyl]propane-1,3-diamine?
The InChIKey is VTXWSJAEIWTHCL-DJNDIFCPSA-N. The full InChI is InChI=1S/C21H44N2.2C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-23-21-18-19-22;2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10,23H,2-8,11-22H2,1H3;2*9-10H,2-8,11-17H2,1H3,(H,19,20)/b3*10-9-.
What are the key properties of bis((Z)-octadec-9-enoic acid);N'-[(Z)-octadec-9-enyl]propane-1,3-diamine?
bis((Z)-octadec-9-enoic acid);N'-[(Z)-octadec-9-enyl]propane-1,3-diamine has a molecular weight of 889.53 g/mol, XLogP of 18.18, 49 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis((Z)-octadec-9-enoic acid);N'-[(Z)-octadec-9-enyl]propane-1,3-diamine is sourced from PubChem (CID 56842667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).