C24H49N5O — CID 56842696
N-(6-amino-2,2,4-trimethylhexyl)-3-[(6-amino-2,2,4-trimethylhexyl)amino]-N-(2-cyanoethyl)propanamide (PubChem CID 56842696) has the molecular formula C24H49N5O and a molecular weight of 423.69 g/mol. Its IUPAC name is N-(6-amino-2,2,4-trimethylhexyl)-3-[(6-amino-2,2,4-trimethylhexyl)amino]-N-(2-cyanoethyl)propanamide.
| Compound Name | N-(6-amino-2,2,4-trimethylhexyl)-3-[(6-amino-2,2,4-trimethylhexyl)amino]-N-(2-cyanoethyl)propanamide |
|---|---|
| PubChem CID | 56842696 |
| Molecular Formula | C24H49N5O |
| Molecular Weight | 423.69 g/mol |
| Exact Mass | 423.39 |
| IUPAC Name | N-(6-amino-2,2,4-trimethylhexyl)-3-[(6-amino-2,2,4-trimethylhexyl)amino]-N-(2-cyanoethyl)propanamide |
| SMILES | CC(CCN)CC(C)(C)CNCCC(=O)N(CCC#N)CC(C)(C)CC(C)CCN |
| InChI | InChI=1S/C24H49N5O/c1-20(8-12-26)16-23(3,4)18-28-14-10-22(30)29(15-7-11-25)19-24(5,6)17-21(2)9-13-27/h20-21,28H,7-10,12-19,26-27H2,1-6H3 |
| InChIKey | SVARGYCJKHGKTH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 108.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.69 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|