2-aminoethanol;2-(carboxymethoxy)acetic acid

C6H13NO6 — CID 56842852

IUPAC2-aminoethanol;2-(carboxymethoxy)acetic acid
SMILESNCCO.O=C(O)COCC(=O)O
InChIInChI=1S/C4H6O5.C2H7NO/c5-3(6)1-9-2-4(7)8;3-1-2-4/h1-2H2,(H,5,6)(H,7,8);4H,1-3H2
InChIKeyXALZKBAFSRZRLS-UHFFFAOYSA-N
MW195.17 g/mol
LogP-1.89
Rot. Bonds5

About 2-aminoethanol;2-(carboxymethoxy)acetic acid

2-aminoethanol;2-(carboxymethoxy)acetic acid (PubChem CID 56842852) has the molecular formula C6H13NO6 and a molecular weight of 195.17 g/mol. Its IUPAC name is 2-aminoethanol;2-(carboxymethoxy)acetic acid.

Molecular Properties

Compound Name2-aminoethanol;2-(carboxymethoxy)acetic acid
PubChem CID56842852
Molecular FormulaC6H13NO6
Molecular Weight195.17 g/mol
Exact Mass195.07
IUPAC Name2-aminoethanol;2-(carboxymethoxy)acetic acid
SMILESNCCO.O=C(O)COCC(=O)O
InChIInChI=1S/C4H6O5.C2H7NO/c5-3(6)1-9-2-4(7)8;3-1-2-4/h1-2H2,(H,5,6)(H,7,8);4H,1-3H2
InChIKeyXALZKBAFSRZRLS-UHFFFAOYSA-N
XLogP-1.89
TPSA130.08 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.17
LogP ≤ 5-1.89
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Analyze 2-aminoethanol;2-(carboxymethoxy)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-aminoethanol;2-(carboxymethoxy)acetic acid?
The IUPAC name of 2-aminoethanol;2-(carboxymethoxy)acetic acid (CID 56842852) is 2-aminoethanol;2-(carboxymethoxy)acetic acid.
What is the SMILES notation for 2-aminoethanol;2-(carboxymethoxy)acetic acid?
The canonical SMILES for 2-aminoethanol;2-(carboxymethoxy)acetic acid is NCCO.O=C(O)COCC(=O)O.
What is the InChIKey of 2-aminoethanol;2-(carboxymethoxy)acetic acid?
The InChIKey is XALZKBAFSRZRLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O5.C2H7NO/c5-3(6)1-9-2-4(7)8;3-1-2-4/h1-2H2,(H,5,6)(H,7,8);4H,1-3H2.
What are the key properties of 2-aminoethanol;2-(carboxymethoxy)acetic acid?
2-aminoethanol;2-(carboxymethoxy)acetic acid has a molecular weight of 195.17 g/mol, XLogP of -1.89, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanol;2-(carboxymethoxy)acetic acid is sourced from PubChem (CID 56842852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).