C16H24O2 — CID 56842886
[(1E,5S,9S)-4,11,11-trimethyl-8-methylidene-5-bicyclo[7.2.0]undec-1-enyl] formate (PubChem CID 56842886) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is [(1E,5S,9S)-4,11,11-trimethyl-8-methylidene-5-bicyclo[7.2.0]undec-1-enyl] formate.
| Compound Name | [(1E,5S,9S)-4,11,11-trimethyl-8-methylidene-5-bicyclo[7.2.0]undec-1-enyl] formate |
|---|---|
| PubChem CID | 56842886 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | [(1E,5S,9S)-4,11,11-trimethyl-8-methylidene-5-bicyclo[7.2.0]undec-1-enyl] formate |
| SMILES | C=C1CC[C@H](OC=O)C(C)C/C=C2\[C@H]1CC2(C)C |
| InChI | InChI=1S/C16H24O2/c1-11-6-8-15(18-10-17)12(2)5-7-14-13(11)9-16(14,3)4/h7,10,12-13,15H,1,5-6,8-9H2,2-4H3/b14-7+/t12?,13-,15-/m0/s1 |
| InChIKey | UOOJILNYXAXCER-RDAOILAASA-N |
| XLogP | 3.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|