C21H29ClN4O8S2 — CID 56843069
(2S)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoic acid;6-chloro-3-(2-methylpropyl)-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide (PubChem CID 56843069) has the molecular formula C21H29ClN4O8S2 and a molecular weight of 565.07 g/mol. Its IUPAC name is (2S)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoic acid;6-chloro-3-(2-methylpropyl)-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide.
| Compound Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoic acid;6-chloro-3-(2-methylpropyl)-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide |
|---|---|
| PubChem CID | 56843069 |
| Molecular Formula | C21H29ClN4O8S2 |
| Molecular Weight | 565.07 g/mol |
| Exact Mass | 564.11 |
| IUPAC Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoic acid;6-chloro-3-(2-methylpropyl)-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide |
| SMILES | CC(C)CC1Nc2cc(Cl)c(S(N)(=O)=O)cc2S(=O)(=O)N1.C[C@](N)(Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C11H16ClN3O4S2.C10H13NO4/c1-6(2)3-11-14-8-4-7(12)9(20(13,16)17)5-10(8)21(18,19)15-11;1-10(11,9(14)15)5-6-2-3-7(12)8(13)4-6/h4-6,11,14-15H,3H2,1-2H3,(H2,13,16,17);2-4,12-13H,5,11H2,1H3,(H,14,15)/t;10-/m.0/s1 |
| InChIKey | DDFNSVFJRVXYQU-CICJTZRQSA-N |
| XLogP | 1.51 |
| TPSA | 222.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.07 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|