C34H40O10 — CID 56843095
benzoic acid;(1S,2S,6R,10S,11R,14R,15R)-1,6,13,14-tetrahydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyltetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dien-5-one (PubChem CID 56843095) has the molecular formula C34H40O10 and a molecular weight of 608.68 g/mol. Its IUPAC name is benzoic acid;(1S,2S,6R,10S,11R,14R,15R)-1,6,13,14-tetrahydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyltetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dien-5-one.
| Compound Name | benzoic acid;(1S,2S,6R,10S,11R,14R,15R)-1,6,13,14-tetrahydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyltetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dien-5-one |
|---|---|
| PubChem CID | 56843095 |
| Molecular Formula | C34H40O10 |
| Molecular Weight | 608.68 g/mol |
| Exact Mass | 608.26 |
| IUPAC Name | benzoic acid;(1S,2S,6R,10S,11R,14R,15R)-1,6,13,14-tetrahydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyltetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dien-5-one |
| SMILES | CC1=C[C@H]2[C@@]3(O)[C@H](C)[C@@H](O)C4(O)[C@H]([C@@H]3C=C(CO)C[C@]2(O)C1=O)C4(C)C.O=C(O)c1ccccc1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C20H28O6.2C7H6O2/c1-9-5-13-18(24,15(9)22)7-11(8-21)6-12-14-17(3,4)20(14,26)16(23)10(2)19(12,13)25;2*8-7(9)6-4-2-1-3-5-6/h5-6,10,12-14,16,21,23-26H,7-8H2,1-4H3;2*1-5H,(H,8,9)/t10-,12+,13-,14-,16-,18-,19-,20?;;/m1../s1 |
| InChIKey | BDXXURBVPCCUJF-VZDYDIMDSA-N |
| XLogP | 2.70 |
| TPSA | 192.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.68 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|