C22H24N8O3S — CID 56843144
4-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzenesulfonamide;3-phenyldiazenylpyridine-2,6-diamine (PubChem CID 56843144) has the molecular formula C22H24N8O3S and a molecular weight of 480.55 g/mol. Its IUPAC name is 4-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzenesulfonamide;3-phenyldiazenylpyridine-2,6-diamine.
| Compound Name | 4-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzenesulfonamide;3-phenyldiazenylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 56843144 |
| Molecular Formula | C22H24N8O3S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 4-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzenesulfonamide;3-phenyldiazenylpyridine-2,6-diamine |
| SMILES | Cc1noc(NS(=O)(=O)c2ccc(N)cc2)c1C.Nc1ccc(/N=N/c2ccccc2)c(N)n1 |
| InChI | InChI=1S/C11H11N5.C11H13N3O3S/c12-10-7-6-9(11(13)14-10)16-15-8-4-2-1-3-5-8;1-7-8(2)13-17-11(7)14-18(15,16)10-5-3-9(12)4-6-10/h1-7H,(H4,12,13,14);3-6,14H,12H2,1-2H3/b16-15+; |
| InChIKey | MEVQYSOOVMLERC-GEEYTBSJSA-N |
| XLogP | 4.34 |
| TPSA | 187.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|