C19H24O6S — CID 56843246
(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[2-[(4-methoxyphenyl)methyl]thiophen-3-yl]oxy-5-methyloxane-3,4-diol (PubChem CID 56843246) has the molecular formula C19H24O6S and a molecular weight of 380.46 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[2-[(4-methoxyphenyl)methyl]thiophen-3-yl]oxy-5-methyloxane-3,4-diol.
| Compound Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[2-[(4-methoxyphenyl)methyl]thiophen-3-yl]oxy-5-methyloxane-3,4-diol |
|---|---|
| PubChem CID | 56843246 |
| Molecular Formula | C19H24O6S |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[2-[(4-methoxyphenyl)methyl]thiophen-3-yl]oxy-5-methyloxane-3,4-diol |
| SMILES | COc1ccc(Cc2sccc2O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2C)cc1 |
| InChI | InChI=1S/C19H24O6S/c1-11-17(21)18(22)15(10-20)25-19(11)24-14-7-8-26-16(14)9-12-3-5-13(23-2)6-4-12/h3-8,11,15,17-22H,9-10H2,1-2H3/t11-,15-,17-,18-,19-/m1/s1 |
| InChIKey | RGVVLCSUJJAUPO-YBLNHRRYSA-N |
| XLogP | 1.80 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |