About (2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)benzoate;platinum(4+)
(2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)benzoate;platinum(4+) (PubChem CID 56843649) has the molecular formula C15H18N2O4Pt
and a molecular weight of 485.40 g/mol. Its IUPAC name is (2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)benzoate;platinum(4+).
Molecular Properties
| Compound Name | (2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)benzoate;platinum(4+) |
| PubChem CID | 56843649 |
| Molecular Formula | C15H18N2O4Pt |
| Molecular Weight | 485.40 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | (2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)benzoate;platinum(4+) |
| SMILES | O=C([O-])Cc1ccccc1C(=O)[O-].[NH-]C1CCCCC1[NH-].[Pt+4] |
| InChI | InChI=1S/C9H8O4.C6H12N2.Pt/c10-8(11)5-6-3-1-2-4-7(6)9(12)13;7-5-3-1-2-4-6(5)8;/h1-4H,5H2,(H,10,11)(H,12,13);5-8H,1-4H2;/q;-2;+4/p-2 |
| InChIKey | PTAYWZBBVSZUQS-UHFFFAOYSA-L |
| XLogP | 0.74 |
| TPSA | 127.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 485.40 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)benzoate;platinum(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)benzoate;platinum(4+)?
The IUPAC name of (2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)benzoate;platinum(4+) (CID 56843649) is (2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)benzoate;platinum(4+).
What is the SMILES notation for (2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)benzoate;platinum(4+)?
The canonical SMILES for (2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)benzoate;platinum(4+) is O=C([O-])Cc1ccccc1C(=O)[O-].[NH-]C1CCCCC1[NH-].[Pt+4].
What is the InChIKey of (2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)benzoate;platinum(4+)?
The InChIKey is PTAYWZBBVSZUQS-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H8O4.C6H12N2.Pt/c10-8(11)5-6-3-1-2-4-7(6)9(12)13;7-5-3-1-2-4-6(5)8;/h1-4H,5H2,(H,10,11)(H,12,13);5-8H,1-4H2;/q;-2;+4/p-2.
What are the key properties of (2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)benzoate;platinum(4+)?
(2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)benzoate;platinum(4+) has a molecular weight of 485.40 g/mol, XLogP of 0.74, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-azanidylcyclohexyl)azanide;2-(carboxylatomethyl)benzoate;platinum(4+) is sourced from PubChem (CID 56843649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).