About barium(2+);bis(3-methylbenzoate)
barium(2+);bis(3-methylbenzoate) (PubChem CID 56843688) has the molecular formula C16H14BaO4
and a molecular weight of 407.61 g/mol. Its IUPAC name is barium(2+);bis(3-methylbenzoate).
Molecular Properties
| Compound Name | barium(2+);bis(3-methylbenzoate) |
| PubChem CID | 56843688 |
| Molecular Formula | C16H14BaO4 |
| Molecular Weight | 407.61 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | barium(2+);bis(3-methylbenzoate) |
| SMILES | Cc1cccc(C(=O)[O-])c1.Cc1cccc(C(=O)[O-])c1.[Ba+2] |
| InChI | InChI=1S/2C8H8O2.Ba/c2*1-6-3-2-4-7(5-6)8(9)10;/h2*2-5H,1H3,(H,9,10);/q;;+2/p-2 |
| InChIKey | HTZMRMLUWYGQFB-UHFFFAOYSA-L |
| XLogP | 0.34 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.61 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze barium(2+);bis(3-methylbenzoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);bis(3-methylbenzoate)?
The IUPAC name of barium(2+);bis(3-methylbenzoate) (CID 56843688) is barium(2+);bis(3-methylbenzoate).
What is the SMILES notation for barium(2+);bis(3-methylbenzoate)?
The canonical SMILES for barium(2+);bis(3-methylbenzoate) is Cc1cccc(C(=O)[O-])c1.Cc1cccc(C(=O)[O-])c1.[Ba+2].
What is the InChIKey of barium(2+);bis(3-methylbenzoate)?
The InChIKey is HTZMRMLUWYGQFB-UHFFFAOYSA-L. The full InChI is InChI=1S/2C8H8O2.Ba/c2*1-6-3-2-4-7(5-6)8(9)10;/h2*2-5H,1H3,(H,9,10);/q;;+2/p-2.
What are the key properties of barium(2+);bis(3-methylbenzoate)?
barium(2+);bis(3-methylbenzoate) has a molecular weight of 407.61 g/mol, XLogP of 0.34, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);bis(3-methylbenzoate) is sourced from PubChem (CID 56843688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).