C12H22N2O3S2 — CID 56843756
2-hydroxysulfonothioyloxy-N'-[(2S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]ethanimidamide (PubChem CID 56843756) has the molecular formula C12H22N2O3S2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 2-hydroxysulfonothioyloxy-N'-[(2S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]ethanimidamide.
| Compound Name | 2-hydroxysulfonothioyloxy-N'-[(2S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]ethanimidamide |
|---|---|
| PubChem CID | 56843756 |
| Molecular Formula | C12H22N2O3S2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 2-hydroxysulfonothioyloxy-N'-[(2S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]ethanimidamide |
| SMILES | CC1(C)C2CCC1(C)[C@@H](/N=C(\N)COS(=O)(O)=S)C2 |
| InChI | InChI=1S/C12H22N2O3S2/c1-11(2)8-4-5-12(11,3)9(6-8)14-10(13)7-17-19(15,16)18/h8-9H,4-7H2,1-3H3,(H2,13,14)(H,15,16,18)/t8?,9-,12?/m0/s1 |
| InChIKey | BCPQGTCBFUWUHC-XEVUQIKYSA-N |
| XLogP | 1.71 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|