About benzoic acid;guanidine
benzoic acid;guanidine (PubChem CID 56843764) has the molecular formula C8H11N3O2
and a molecular weight of 181.19 g/mol. Its IUPAC name is benzoic acid;guanidine.
Molecular Properties
| Compound Name | benzoic acid;guanidine |
| PubChem CID | 56843764 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | benzoic acid;guanidine |
| SMILES | O=C(O)c1ccccc1.[H]N=C(N)N |
| InChI | InChI=1S/C7H6O2.CH5N3/c8-7(9)6-4-2-1-3-5-6;2-1(3)4/h1-5H,(H,8,9);(H5,2,3,4) |
| InChIKey | DNOSZYUZVCJLMM-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 113.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze benzoic acid;guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;guanidine?
The IUPAC name of benzoic acid;guanidine (CID 56843764) is benzoic acid;guanidine.
What is the SMILES notation for benzoic acid;guanidine?
The canonical SMILES for benzoic acid;guanidine is O=C(O)c1ccccc1.[H]N=C(N)N.
What is the InChIKey of benzoic acid;guanidine?
The InChIKey is DNOSZYUZVCJLMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.CH5N3/c8-7(9)6-4-2-1-3-5-6;2-1(3)4/h1-5H,(H,8,9);(H5,2,3,4).
What are the key properties of benzoic acid;guanidine?
benzoic acid;guanidine has a molecular weight of 181.19 g/mol, XLogP of 0.22, 1 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;guanidine is sourced from PubChem (CID 56843764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).