About 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;hydrobromide
1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;hydrobromide (PubChem CID 56843850) has the molecular formula C18H23BrN2S
and a molecular weight of 379.37 g/mol. Its IUPAC name is 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;hydrobromide.
Molecular Properties
| Compound Name | 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;hydrobromide |
| PubChem CID | 56843850 |
| Molecular Formula | C18H23BrN2S |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;hydrobromide |
| SMILES | Br.Cc1ccc(Sc2ccccc2N2CCNCC2)c(C)c1 |
| InChI | InChI=1S/C18H22N2S.BrH/c1-14-7-8-17(15(2)13-14)21-18-6-4-3-5-16(18)20-11-9-19-10-12-20;/h3-8,13,19H,9-12H2,1-2H3;1H |
| InChIKey | VNGRUFUIHGGOOM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;hydrobromide?
The IUPAC name of 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;hydrobromide (CID 56843850) is 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;hydrobromide.
What is the SMILES notation for 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;hydrobromide?
The canonical SMILES for 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;hydrobromide is Br.Cc1ccc(Sc2ccccc2N2CCNCC2)c(C)c1.
What is the InChIKey of 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;hydrobromide?
The InChIKey is VNGRUFUIHGGOOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2S.BrH/c1-14-7-8-17(15(2)13-14)21-18-6-4-3-5-16(18)20-11-9-19-10-12-20;/h3-8,13,19H,9-12H2,1-2H3;1H.
What are the key properties of 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;hydrobromide?
1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;hydrobromide has a molecular weight of 379.37 g/mol, XLogP of 4.44, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;hydrobromide is sourced from PubChem (CID 56843850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).