C12H18O7 — CID 56844036
6-[[(3S,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-oxohexanoic acid (PubChem CID 56844036) has the molecular formula C12H18O7 and a molecular weight of 274.27 g/mol. Its IUPAC name is 6-[[(3S,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-oxohexanoic acid.
| Compound Name | 6-[[(3S,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 56844036 |
| Molecular Formula | C12H18O7 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 6-[[(3S,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-oxohexanoic acid |
| SMILES | O=C(O)CCCCC(=O)O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2O |
| InChI | InChI=1S/C12H18O7/c13-7-5-17-12-8(6-18-11(7)12)19-10(16)4-2-1-3-9(14)15/h7-8,11-13H,1-6H2,(H,14,15)/t7-,8+,11+,12+/m0/s1 |
| InChIKey | OPJJGJSABZUPPN-JTRYMVSWSA-N |
| XLogP | -0.30 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|