C11H22BNO3 — CID 56844371
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(1,2,3,6-tetrahydropyridin-4-yl)borinic acid (PubChem CID 56844371) has the molecular formula C11H22BNO3 and a molecular weight of 227.11 g/mol. Its IUPAC name is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(1,2,3,6-tetrahydropyridin-4-yl)borinic acid.
| Compound Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(1,2,3,6-tetrahydropyridin-4-yl)borinic acid |
|---|---|
| PubChem CID | 56844371 |
| Molecular Formula | C11H22BNO3 |
| Molecular Weight | 227.11 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(1,2,3,6-tetrahydropyridin-4-yl)borinic acid |
| SMILES | CC(C)(O)C(C)(C)OB(O)C1=CCNCC1 |
| InChI | InChI=1S/C11H22BNO3/c1-10(2,14)11(3,4)16-12(15)9-5-7-13-8-6-9/h5,13-15H,6-8H2,1-4H3 |
| InChIKey | PZGQLLILLVUKER-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.11 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|