C11H20BNO3S — CID 56844524
(2,4-dimethyl-1,3-thiazol-5-yl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid (PubChem CID 56844524) has the molecular formula C11H20BNO3S and a molecular weight of 257.16 g/mol. Its IUPAC name is (2,4-dimethyl-1,3-thiazol-5-yl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid.
| Compound Name | (2,4-dimethyl-1,3-thiazol-5-yl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
|---|---|
| PubChem CID | 56844524 |
| Molecular Formula | C11H20BNO3S |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | (2,4-dimethyl-1,3-thiazol-5-yl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
| SMILES | Cc1nc(C)c(B(O)OC(C)(C)C(C)(C)O)s1 |
| InChI | InChI=1S/C11H20BNO3S/c1-7-9(17-8(2)13-7)12(15)16-11(5,6)10(3,4)14/h14-15H,1-6H3 |
| InChIKey | ZTRJGXSACHLCHH-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|